C19H23BrN2O — CID 156717069
4-[(E)-1-bromoprop-1-enyl]-1-[(4-methoxyphenyl)methyl]-5-methylpyrazole;but-1-yne (PubChem CID 156717069) has the molecular formula C19H23BrN2O and a molecular weight of 375.31 g/mol. Its IUPAC name is 4-[(E)-1-bromoprop-1-enyl]-1-[(4-methoxyphenyl)methyl]-5-methylpyrazole;but-1-yne.
| Compound Name | 4-[(E)-1-bromoprop-1-enyl]-1-[(4-methoxyphenyl)methyl]-5-methylpyrazole;but-1-yne |
|---|---|
| PubChem CID | 156717069 |
| Molecular Formula | C19H23BrN2O |
| Molecular Weight | 375.31 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 4-[(E)-1-bromoprop-1-enyl]-1-[(4-methoxyphenyl)methyl]-5-methylpyrazole;but-1-yne |
| SMILES | C#CCC.C/C=C(/Br)c1cnn(Cc2ccc(OC)cc2)c1C |
| InChI | InChI=1S/C15H17BrN2O.C4H6/c1-4-15(16)14-9-17-18(11(14)2)10-12-5-7-13(19-3)8-6-12;1-3-4-2/h4-9H,10H2,1-3H3;1H,4H2,2H3/b15-4+; |
| InChIKey | HGDJHSJFBSKUOP-HDNKIUSMSA-N |
| XLogP | 5.03 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.31 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|