C17H19ClN2O2P+ — CID 156718055
2-[4-(3-chloro-4-methylphenyl)spiro[2H-[1,3]oxaphospholo[5,4-c]pyridin-1-ium-1,2'-oxaphosphiran-2-ium]-6-yl]-N-methylethanamine (PubChem CID 156718055) has the molecular formula C17H19ClN2O2P+ and a molecular weight of 349.78 g/mol. Its IUPAC name is 2-[4-(3-chloro-4-methylphenyl)spiro[2H-[1,3]oxaphospholo[5,4-c]pyridin-1-ium-1,2'-oxaphosphiran-2-ium]-6-yl]-N-methylethanamine.
| Compound Name | 2-[4-(3-chloro-4-methylphenyl)spiro[2H-[1,3]oxaphospholo[5,4-c]pyridin-1-ium-1,2'-oxaphosphiran-2-ium]-6-yl]-N-methylethanamine |
|---|---|
| PubChem CID | 156718055 |
| Molecular Formula | C17H19ClN2O2P+ |
| Molecular Weight | 349.78 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 2-[4-(3-chloro-4-methylphenyl)spiro[2H-[1,3]oxaphospholo[5,4-c]pyridin-1-ium-1,2'-oxaphosphiran-2-ium]-6-yl]-N-methylethanamine |
| SMILES | CNCCc1cc2c(c(-c3ccc(C)c(Cl)c3)n1)OC[P+]21CO1 |
| InChI | InChI=1S/C17H19ClN2O2P/c1-11-3-4-12(7-14(11)18)16-17-15(23(9-21-17)10-22-23)8-13(20-16)5-6-19-2/h3-4,7-8,19H,5-6,9-10H2,1-2H3/q+1 |
| InChIKey | DLDLXJFXLQTNCN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 46.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.78 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|