C14H17F3O3S — CID 156719264
6-hydroxy-7-[4-(trifluoromethyl)phenyl]sulfanylheptanoic acid (PubChem CID 156719264) has the molecular formula C14H17F3O3S and a molecular weight of 322.35 g/mol. Its IUPAC name is 6-hydroxy-7-[4-(trifluoromethyl)phenyl]sulfanylheptanoic acid.
| Compound Name | 6-hydroxy-7-[4-(trifluoromethyl)phenyl]sulfanylheptanoic acid |
|---|---|
| PubChem CID | 156719264 |
| Molecular Formula | C14H17F3O3S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 6-hydroxy-7-[4-(trifluoromethyl)phenyl]sulfanylheptanoic acid |
| SMILES | O=C(O)CCCCC(O)CSc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H17F3O3S/c15-14(16,17)10-5-7-12(8-6-10)21-9-11(18)3-1-2-4-13(19)20/h5-8,11,18H,1-4,9H2,(H,19,20) |
| InChIKey | WZIFEUWDCBWHHS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|