C21H33N3O2 — CID 156719597
4-methyl-2-[3-[1-(piperidin-4-ylmethyl)piperidin-4-yl]oxycyclobutyl]oxypyridine (PubChem CID 156719597) has the molecular formula C21H33N3O2 and a molecular weight of 359.51 g/mol. Its IUPAC name is 4-methyl-2-[3-[1-(piperidin-4-ylmethyl)piperidin-4-yl]oxycyclobutyl]oxypyridine.
| Compound Name | 4-methyl-2-[3-[1-(piperidin-4-ylmethyl)piperidin-4-yl]oxycyclobutyl]oxypyridine |
|---|---|
| PubChem CID | 156719597 |
| Molecular Formula | C21H33N3O2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | 4-methyl-2-[3-[1-(piperidin-4-ylmethyl)piperidin-4-yl]oxycyclobutyl]oxypyridine |
| SMILES | Cc1ccnc(OC2CC(OC3CCN(CC4CCNCC4)CC3)C2)c1 |
| InChI | InChI=1S/C21H33N3O2/c1-16-2-9-23-21(12-16)26-20-13-19(14-20)25-18-5-10-24(11-6-18)15-17-3-7-22-8-4-17/h2,9,12,17-20,22H,3-8,10-11,13-15H2,1H3 |
| InChIKey | OTLVETIKFLXQGF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |