C18H27ClN2O — CID 69260286
4-(4-chloro-3-methylphenoxy)-1-(piperidin-4-ylmethyl)piperidine (PubChem CID 69260286) has the molecular formula C18H27ClN2O and a molecular weight of 322.88 g/mol. Its IUPAC name is 4-(4-chloro-3-methylphenoxy)-1-(piperidin-4-ylmethyl)piperidine.
| Compound Name | 4-(4-chloro-3-methylphenoxy)-1-(piperidin-4-ylmethyl)piperidine |
|---|---|
| PubChem CID | 69260286 |
| Molecular Formula | C18H27ClN2O |
| Molecular Weight | 322.88 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 4-(4-chloro-3-methylphenoxy)-1-(piperidin-4-ylmethyl)piperidine |
| SMILES | Cc1cc(OC2CCN(CC3CCNCC3)CC2)ccc1Cl |
| InChI | InChI=1S/C18H27ClN2O/c1-14-12-17(2-3-18(14)19)22-16-6-10-21(11-7-16)13-15-4-8-20-9-5-15/h2-3,12,15-16,20H,4-11,13H2,1H3 |
| InChIKey | WIFIIXHKGDUFBY-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.88 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |