C18H24N2O3 — CID 156719812
(2S)-1-[2-[3,4-bis(ethenyl)-5-oxo-2H-pyrrol-1-yl]-3-methylbutanoyl]pyrrolidine-2-carbaldehyde (PubChem CID 156719812) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is (2S)-1-[2-[3,4-bis(ethenyl)-5-oxo-2H-pyrrol-1-yl]-3-methylbutanoyl]pyrrolidine-2-carbaldehyde.
| Compound Name | (2S)-1-[2-[3,4-bis(ethenyl)-5-oxo-2H-pyrrol-1-yl]-3-methylbutanoyl]pyrrolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 156719812 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | (2S)-1-[2-[3,4-bis(ethenyl)-5-oxo-2H-pyrrol-1-yl]-3-methylbutanoyl]pyrrolidine-2-carbaldehyde |
| SMILES | C=CC1=C(C=C)C(=O)N(C(C(=O)N2CCC[C@H]2C=O)C(C)C)C1 |
| InChI | InChI=1S/C18H24N2O3/c1-5-13-10-20(17(22)15(13)6-2)16(12(3)4)18(23)19-9-7-8-14(19)11-21/h5-6,11-12,14,16H,1-2,7-10H2,3-4H3/t14-,16?/m0/s1 |
| InChIKey | LAZIVNVZYLDGMC-LBAUFKAWSA-N |
| XLogP | 1.71 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|