C19H29N3O3 — CID 145262011
2-[3,4-bis(ethenyl)-5-oxo-2H-pyrrol-1-yl]-3-methylbutanal;1-methylpyrrolidine-2-carboxamide (PubChem CID 145262011) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is 2-[3,4-bis(ethenyl)-5-oxo-2H-pyrrol-1-yl]-3-methylbutanal;1-methylpyrrolidine-2-carboxamide.
| Compound Name | 2-[3,4-bis(ethenyl)-5-oxo-2H-pyrrol-1-yl]-3-methylbutanal;1-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 145262011 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | 2-[3,4-bis(ethenyl)-5-oxo-2H-pyrrol-1-yl]-3-methylbutanal;1-methylpyrrolidine-2-carboxamide |
| SMILES | C=CC1=C(C=C)C(=O)N(C(C=O)C(C)C)C1.CN1CCCC1C(N)=O |
| InChI | InChI=1S/C13H17NO2.C6H12N2O/c1-5-10-7-14(12(8-15)9(3)4)13(16)11(10)6-2;1-8-4-2-3-5(8)6(7)9/h5-6,8-9,12H,1-2,7H2,3-4H3;5H,2-4H2,1H3,(H2,7,9) |
| InChIKey | JDOJLMJADSGMIH-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|