About 1-[2-(4-propylpiperazin-1-yl)ethyl]azetidin-3-ol;tungsten
1-[2-(4-propylpiperazin-1-yl)ethyl]azetidin-3-ol;tungsten (PubChem CID 156720012) has the molecular formula C12H25N3OW
and a molecular weight of 411.19 g/mol. Its IUPAC name is 1-[2-(4-propylpiperazin-1-yl)ethyl]azetidin-3-ol;tungsten.
Molecular Properties
| Compound Name | 1-[2-(4-propylpiperazin-1-yl)ethyl]azetidin-3-ol;tungsten |
| PubChem CID | 156720012 |
| Molecular Formula | C12H25N3OW |
| Molecular Weight | 411.19 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 1-[2-(4-propylpiperazin-1-yl)ethyl]azetidin-3-ol;tungsten |
| SMILES | CCCN1CCN(CCN2CC(O)C2)CC1.[W] |
| InChI | InChI=1S/C12H25N3O.W/c1-2-3-13-4-6-14(7-5-13)8-9-15-10-12(16)11-15;/h12,16H,2-11H2,1H3; |
| InChIKey | VSHGRVSZTKRYIZ-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.19 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(4-propylpiperazin-1-yl)ethyl]azetidin-3-ol;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(4-propylpiperazin-1-yl)ethyl]azetidin-3-ol;tungsten?
The IUPAC name of 1-[2-(4-propylpiperazin-1-yl)ethyl]azetidin-3-ol;tungsten (CID 156720012) is 1-[2-(4-propylpiperazin-1-yl)ethyl]azetidin-3-ol;tungsten.
What is the SMILES notation for 1-[2-(4-propylpiperazin-1-yl)ethyl]azetidin-3-ol;tungsten?
The canonical SMILES for 1-[2-(4-propylpiperazin-1-yl)ethyl]azetidin-3-ol;tungsten is CCCN1CCN(CCN2CC(O)C2)CC1.[W].
What is the InChIKey of 1-[2-(4-propylpiperazin-1-yl)ethyl]azetidin-3-ol;tungsten?
The InChIKey is VSHGRVSZTKRYIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N3O.W/c1-2-3-13-4-6-14(7-5-13)8-9-15-10-12(16)11-15;/h12,16H,2-11H2,1H3;.
What are the key properties of 1-[2-(4-propylpiperazin-1-yl)ethyl]azetidin-3-ol;tungsten?
1-[2-(4-propylpiperazin-1-yl)ethyl]azetidin-3-ol;tungsten has a molecular weight of 411.19 g/mol, XLogP of -0.31, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(4-propylpiperazin-1-yl)ethyl]azetidin-3-ol;tungsten is sourced from PubChem (CID 156720012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).