C24H31NO5 — CID 156722046
[3-(methoxymethyl)phenyl]methanol;4-[1-(3-methylbutanoylamino)cyclopropyl]benzoic acid (PubChem CID 156722046) has the molecular formula C24H31NO5 and a molecular weight of 413.51 g/mol. Its IUPAC name is [3-(methoxymethyl)phenyl]methanol;4-[1-(3-methylbutanoylamino)cyclopropyl]benzoic acid.
| Compound Name | [3-(methoxymethyl)phenyl]methanol;4-[1-(3-methylbutanoylamino)cyclopropyl]benzoic acid |
|---|---|
| PubChem CID | 156722046 |
| Molecular Formula | C24H31NO5 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | [3-(methoxymethyl)phenyl]methanol;4-[1-(3-methylbutanoylamino)cyclopropyl]benzoic acid |
| SMILES | CC(C)CC(=O)NC1(c2ccc(C(=O)O)cc2)CC1.COCc1cccc(CO)c1 |
| InChI | InChI=1S/C15H19NO3.C9H12O2/c1-10(2)9-13(17)16-15(7-8-15)12-5-3-11(4-6-12)14(18)19;1-11-7-9-4-2-3-8(5-9)6-10/h3-6,10H,7-9H2,1-2H3,(H,16,17)(H,18,19);2-5,10H,6-7H2,1H3 |
| InChIKey | CVMCILFCDGCBPS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |