C42H76 — CID 156722610
[7-(6-cyclohexyl-5-methyl-3-methylidenehexyl)-2,11,13-trimethyl-4,9-dimethylideneheptadecyl]cyclohexane (PubChem CID 156722610) has the molecular formula C42H76 and a molecular weight of 581.07 g/mol. Its IUPAC name is [7-(6-cyclohexyl-5-methyl-3-methylidenehexyl)-2,11,13-trimethyl-4,9-dimethylideneheptadecyl]cyclohexane.
| Compound Name | [7-(6-cyclohexyl-5-methyl-3-methylidenehexyl)-2,11,13-trimethyl-4,9-dimethylideneheptadecyl]cyclohexane |
|---|---|
| PubChem CID | 156722610 |
| Molecular Formula | C42H76 |
| Molecular Weight | 581.07 g/mol |
| Exact Mass | 580.59 |
| IUPAC Name | [7-(6-cyclohexyl-5-methyl-3-methylidenehexyl)-2,11,13-trimethyl-4,9-dimethylideneheptadecyl]cyclohexane |
| SMILES | C=C(CCC(CCC(=C)CC(C)CC1CCCCC1)CC(=C)CC(C)CC(C)CCCC)CC(C)CC1CCCCC1 |
| InChI | InChI=1S/C42H76/c1-9-10-17-33(2)26-36(5)29-39(8)32-42(24-22-34(3)27-37(6)30-40-18-13-11-14-19-40)25-23-35(4)28-38(7)31-41-20-15-12-16-21-41/h33,36-38,40-42H,3-4,8-32H2,1-2,5-7H3 |
| InChIKey | MTBWHBAHDFCCGX-UHFFFAOYSA-N |
| XLogP | 14.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.07 |
| LogP ≤ 5 | 14.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|