C16H24Cl2N2O3 — CID 156723137
2-(aminomethyl)-4,5-dichlorophenol;3-hydroxy-1-[(3S)-3-methylpiperidin-1-yl]propan-1-one (PubChem CID 156723137) has the molecular formula C16H24Cl2N2O3 and a molecular weight of 363.29 g/mol. Its IUPAC name is 2-(aminomethyl)-4,5-dichlorophenol;3-hydroxy-1-[(3S)-3-methylpiperidin-1-yl]propan-1-one.
| Compound Name | 2-(aminomethyl)-4,5-dichlorophenol;3-hydroxy-1-[(3S)-3-methylpiperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 156723137 |
| Molecular Formula | C16H24Cl2N2O3 |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 2-(aminomethyl)-4,5-dichlorophenol;3-hydroxy-1-[(3S)-3-methylpiperidin-1-yl]propan-1-one |
| SMILES | C[C@H]1CCCN(C(=O)CCO)C1.NCc1cc(Cl)c(Cl)cc1O |
| InChI | InChI=1S/C9H17NO2.C7H7Cl2NO/c1-8-3-2-5-10(7-8)9(12)4-6-11;8-5-1-4(3-10)7(11)2-6(5)9/h8,11H,2-7H2,1H3;1-2,11H,3,10H2/t8-;/m0./s1 |
| InChIKey | YWRITTUTMKIFCW-QRPNPIFTSA-N |
| XLogP | 2.79 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|