C19H24Cl2N2O4 — CID 147203332
N-[(3R)-1-[3-(4,5-dichloro-2-hydroxyphenyl)propanoyl]piperidin-3-yl]-N-(2-hydroxyethyl)prop-2-enamide (PubChem CID 147203332) has the molecular formula C19H24Cl2N2O4 and a molecular weight of 415.32 g/mol. Its IUPAC name is N-[(3R)-1-[3-(4,5-dichloro-2-hydroxyphenyl)propanoyl]piperidin-3-yl]-N-(2-hydroxyethyl)prop-2-enamide.
| Compound Name | N-[(3R)-1-[3-(4,5-dichloro-2-hydroxyphenyl)propanoyl]piperidin-3-yl]-N-(2-hydroxyethyl)prop-2-enamide |
|---|---|
| PubChem CID | 147203332 |
| Molecular Formula | C19H24Cl2N2O4 |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | N-[(3R)-1-[3-(4,5-dichloro-2-hydroxyphenyl)propanoyl]piperidin-3-yl]-N-(2-hydroxyethyl)prop-2-enamide |
| SMILES | C=CC(=O)N(CCO)[C@@H]1CCCN(C(=O)CCc2cc(Cl)c(Cl)cc2O)C1 |
| InChI | InChI=1S/C19H24Cl2N2O4/c1-2-18(26)23(8-9-24)14-4-3-7-22(12-14)19(27)6-5-13-10-15(20)16(21)11-17(13)25/h2,10-11,14,24-25H,1,3-9,12H2/t14-/m1/s1 |
| InChIKey | CDTNURRYLGRPMF-CQSZACIVSA-N |
| XLogP | 2.63 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|