C22H30Cl2N2O4S — CID 156723281
tert-butyl 3-[4-(4,5-dichloro-2-methoxybenzoyl)piperidin-1-yl]sulfanylpyrrolidine-1-carboxylate (PubChem CID 156723281) has the molecular formula C22H30Cl2N2O4S and a molecular weight of 489.47 g/mol. Its IUPAC name is tert-butyl 3-[4-(4,5-dichloro-2-methoxybenzoyl)piperidin-1-yl]sulfanylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-(4,5-dichloro-2-methoxybenzoyl)piperidin-1-yl]sulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 156723281 |
| Molecular Formula | C22H30Cl2N2O4S |
| Molecular Weight | 489.47 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | tert-butyl 3-[4-(4,5-dichloro-2-methoxybenzoyl)piperidin-1-yl]sulfanylpyrrolidine-1-carboxylate |
| SMILES | COc1cc(Cl)c(Cl)cc1C(=O)C1CCN(SC2CCN(C(=O)OC(C)(C)C)C2)CC1 |
| InChI | InChI=1S/C22H30Cl2N2O4S/c1-22(2,3)30-21(28)25-8-7-15(13-25)31-26-9-5-14(6-10-26)20(27)16-11-17(23)18(24)12-19(16)29-4/h11-12,14-15H,5-10,13H2,1-4H3 |
| InChIKey | FAJPTLAXQZLKNM-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.47 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|