C21H26N4OS — CID 156724227
6-(but-1-en-2-ylamino)pyridine-3-carbonitrile;3-(1-phenylethylsulfanyl)propanamide (PubChem CID 156724227) has the molecular formula C21H26N4OS and a molecular weight of 382.53 g/mol. Its IUPAC name is 6-(but-1-en-2-ylamino)pyridine-3-carbonitrile;3-(1-phenylethylsulfanyl)propanamide.
| Compound Name | 6-(but-1-en-2-ylamino)pyridine-3-carbonitrile;3-(1-phenylethylsulfanyl)propanamide |
|---|---|
| PubChem CID | 156724227 |
| Molecular Formula | C21H26N4OS |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 6-(but-1-en-2-ylamino)pyridine-3-carbonitrile;3-(1-phenylethylsulfanyl)propanamide |
| SMILES | C=C(CC)Nc1ccc(C#N)cn1.CC(SCCC(N)=O)c1ccccc1 |
| InChI | InChI=1S/C11H15NOS.C10H11N3/c1-9(14-8-7-11(12)13)10-5-3-2-4-6-10;1-3-8(2)13-10-5-4-9(6-11)7-12-10/h2-6,9H,7-8H2,1H3,(H2,12,13);4-5,7H,2-3H2,1H3,(H,12,13) |
| InChIKey | QRUPSBFZVAKCNF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |