C21H25F4N5O — CID 156723908
6-(but-1-en-2-ylamino)pyridine-3-carbonitrile;difluoromethane;3-[(3,4-difluorophenyl)methylamino]propanamide (PubChem CID 156723908) has the molecular formula C21H25F4N5O and a molecular weight of 439.46 g/mol. Its IUPAC name is 6-(but-1-en-2-ylamino)pyridine-3-carbonitrile;difluoromethane;3-[(3,4-difluorophenyl)methylamino]propanamide.
| Compound Name | 6-(but-1-en-2-ylamino)pyridine-3-carbonitrile;difluoromethane;3-[(3,4-difluorophenyl)methylamino]propanamide |
|---|---|
| PubChem CID | 156723908 |
| Molecular Formula | C21H25F4N5O |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 6-(but-1-en-2-ylamino)pyridine-3-carbonitrile;difluoromethane;3-[(3,4-difluorophenyl)methylamino]propanamide |
| SMILES | C=C(CC)Nc1ccc(C#N)cn1.FCF.NC(=O)CCNCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H12F2N2O.C10H11N3.CH2F2/c11-8-2-1-7(5-9(8)12)6-14-4-3-10(13)15;1-3-8(2)13-10-5-4-9(6-11)7-12-10;2-1-3/h1-2,5,14H,3-4,6H2,(H2,13,15);4-5,7H,2-3H2,1H3,(H,12,13);1H2 |
| InChIKey | GZMWUUSGRNPAHN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|