C24H22Cl2N6O3 — CID 143085126
2-amino-N-[2-[4-chloro-2-[(5-cyano-2-pyridinyl)carbamoylamino]phenoxy]ethyl]-3-(4-chlorophenyl)propanamide (PubChem CID 143085126) has the molecular formula C24H22Cl2N6O3 and a molecular weight of 513.39 g/mol. Its IUPAC name is 2-amino-N-[2-[4-chloro-2-[(5-cyano-2-pyridinyl)carbamoylamino]phenoxy]ethyl]-3-(4-chlorophenyl)propanamide.
| Compound Name | 2-amino-N-[2-[4-chloro-2-[(5-cyano-2-pyridinyl)carbamoylamino]phenoxy]ethyl]-3-(4-chlorophenyl)propanamide |
|---|---|
| PubChem CID | 143085126 |
| Molecular Formula | C24H22Cl2N6O3 |
| Molecular Weight | 513.39 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | 2-amino-N-[2-[4-chloro-2-[(5-cyano-2-pyridinyl)carbamoylamino]phenoxy]ethyl]-3-(4-chlorophenyl)propanamide |
| SMILES | N#Cc1ccc(NC(=O)Nc2cc(Cl)ccc2OCCNC(=O)C(N)Cc2ccc(Cl)cc2)nc1 |
| InChI | InChI=1S/C24H22Cl2N6O3/c25-17-4-1-15(2-5-17)11-19(28)23(33)29-9-10-35-21-7-6-18(26)12-20(21)31-24(34)32-22-8-3-16(13-27)14-30-22/h1-8,12,14,19H,9-11,28H2,(H,29,33)(H2,30,31,32,34) |
| InChIKey | UUFIOJZZYJNKGR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 142.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|