C24H20ClN7O3 — CID 91023777
1-[5-chloro-2-[3-[(2-cyanophenyl)carbamoylamino]propoxy]phenyl]-3-(5-cyano-2-pyridinyl)urea (PubChem CID 91023777) has the molecular formula C24H20ClN7O3 and a molecular weight of 489.92 g/mol. Its IUPAC name is 1-[5-chloro-2-[3-[(2-cyanophenyl)carbamoylamino]propoxy]phenyl]-3-(5-cyano-2-pyridinyl)urea.
| Compound Name | 1-[5-chloro-2-[3-[(2-cyanophenyl)carbamoylamino]propoxy]phenyl]-3-(5-cyano-2-pyridinyl)urea |
|---|---|
| PubChem CID | 91023777 |
| Molecular Formula | C24H20ClN7O3 |
| Molecular Weight | 489.92 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | 1-[5-chloro-2-[3-[(2-cyanophenyl)carbamoylamino]propoxy]phenyl]-3-(5-cyano-2-pyridinyl)urea |
| SMILES | N#Cc1ccc(NC(=O)Nc2cc(Cl)ccc2OCCCNC(=O)Nc2ccccc2C#N)nc1 |
| InChI | InChI=1S/C24H20ClN7O3/c25-18-7-8-21(20(12-18)31-24(34)32-22-9-6-16(13-26)15-29-22)35-11-3-10-28-23(33)30-19-5-2-1-4-17(19)14-27/h1-2,4-9,12,15H,3,10-11H2,(H2,28,30,33)(H2,29,31,32,34) |
| InChIKey | JVWJKSDNXDMFHZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 151.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.92 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|