C23H23ClN6O3S — CID 11409406
1-[3-[4-chloro-2-[(5-cyano-2-pyridinyl)carbamoylamino]phenoxy]propyl]-3-(2-thiophen-3-ylethyl)urea (PubChem CID 11409406) has the molecular formula C23H23ClN6O3S and a molecular weight of 499.00 g/mol. Its IUPAC name is 1-[3-[4-chloro-2-[(5-cyano-2-pyridinyl)carbamoylamino]phenoxy]propyl]-3-(2-thiophen-3-ylethyl)urea.
| Compound Name | 1-[3-[4-chloro-2-[(5-cyano-2-pyridinyl)carbamoylamino]phenoxy]propyl]-3-(2-thiophen-3-ylethyl)urea |
|---|---|
| PubChem CID | 11409406 |
| Molecular Formula | C23H23ClN6O3S |
| Molecular Weight | 499.00 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | 1-[3-[4-chloro-2-[(5-cyano-2-pyridinyl)carbamoylamino]phenoxy]propyl]-3-(2-thiophen-3-ylethyl)urea |
| SMILES | N#Cc1ccc(NC(=O)Nc2cc(Cl)ccc2OCCCNC(=O)NCCc2ccsc2)nc1 |
| InChI | InChI=1S/C23H23ClN6O3S/c24-18-3-4-20(19(12-18)29-23(32)30-21-5-2-17(13-25)14-28-21)33-10-1-8-26-22(31)27-9-6-16-7-11-34-15-16/h2-5,7,11-12,14-15H,1,6,8-10H2,(H2,26,27,31)(H2,28,29,30,32) |
| InChIKey | OKUSSVIKTGCZJS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 128.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.00 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|