C24H30ClN7O3 — CID 90794938
1-[3-[4-chloro-2-[(5-cyano-2-pyridinyl)carbamoylamino]phenoxy]propyl]-3-(1-pyrrolidin-1-ylpropyl)urea (PubChem CID 90794938) has the molecular formula C24H30ClN7O3 and a molecular weight of 500.00 g/mol. Its IUPAC name is 1-[3-[4-chloro-2-[(5-cyano-2-pyridinyl)carbamoylamino]phenoxy]propyl]-3-(1-pyrrolidin-1-ylpropyl)urea.
| Compound Name | 1-[3-[4-chloro-2-[(5-cyano-2-pyridinyl)carbamoylamino]phenoxy]propyl]-3-(1-pyrrolidin-1-ylpropyl)urea |
|---|---|
| PubChem CID | 90794938 |
| Molecular Formula | C24H30ClN7O3 |
| Molecular Weight | 500.00 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | 1-[3-[4-chloro-2-[(5-cyano-2-pyridinyl)carbamoylamino]phenoxy]propyl]-3-(1-pyrrolidin-1-ylpropyl)urea |
| SMILES | CCC(NC(=O)NCCCOc1ccc(Cl)cc1NC(=O)Nc1ccc(C#N)cn1)N1CCCC1 |
| InChI | InChI=1S/C24H30ClN7O3/c1-2-22(32-11-3-4-12-32)31-23(33)27-10-5-13-35-20-8-7-18(25)14-19(20)29-24(34)30-21-9-6-17(15-26)16-28-21/h6-9,14,16,22H,2-5,10-13H2,1H3,(H2,27,31,33)(H2,28,29,30,34) |
| InChIKey | JUALGGPPWBLFGD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 131.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.00 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|