C16H21ClN6O2 — CID 71150832
1-(5-aminopyrazin-2-yl)-3-[5-chloro-2-[3-(dimethylamino)propoxy]phenyl]urea (PubChem CID 71150832) has the molecular formula C16H21ClN6O2 and a molecular weight of 364.84 g/mol. Its IUPAC name is 1-(5-aminopyrazin-2-yl)-3-[5-chloro-2-[3-(dimethylamino)propoxy]phenyl]urea.
| Compound Name | 1-(5-aminopyrazin-2-yl)-3-[5-chloro-2-[3-(dimethylamino)propoxy]phenyl]urea |
|---|---|
| PubChem CID | 71150832 |
| Molecular Formula | C16H21ClN6O2 |
| Molecular Weight | 364.84 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 1-(5-aminopyrazin-2-yl)-3-[5-chloro-2-[3-(dimethylamino)propoxy]phenyl]urea |
| SMILES | CN(C)CCCOc1ccc(Cl)cc1NC(=O)Nc1cnc(N)cn1 |
| InChI | InChI=1S/C16H21ClN6O2/c1-23(2)6-3-7-25-13-5-4-11(17)8-12(13)21-16(24)22-15-10-19-14(18)9-20-15/h4-5,8-10H,3,6-7H2,1-2H3,(H2,18,19)(H2,20,21,22,24) |
| InChIKey | XMHSEUYCWRQCEX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.84 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|