C17H22ClN5O2 — CID 18449131
1-[5-chloro-2-[3-(dimethylamino)propoxy]phenyl]-3-(5-methylpyrazin-2-yl)urea (PubChem CID 18449131) has the molecular formula C17H22ClN5O2 and a molecular weight of 363.85 g/mol. Its IUPAC name is 1-[5-chloro-2-[3-(dimethylamino)propoxy]phenyl]-3-(5-methylpyrazin-2-yl)urea.
| Compound Name | 1-[5-chloro-2-[3-(dimethylamino)propoxy]phenyl]-3-(5-methylpyrazin-2-yl)urea |
|---|---|
| PubChem CID | 18449131 |
| Molecular Formula | C17H22ClN5O2 |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 1-[5-chloro-2-[3-(dimethylamino)propoxy]phenyl]-3-(5-methylpyrazin-2-yl)urea |
| SMILES | Cc1cnc(NC(=O)Nc2cc(Cl)ccc2OCCCN(C)C)cn1 |
| InChI | InChI=1S/C17H22ClN5O2/c1-12-10-20-16(11-19-12)22-17(24)21-14-9-13(18)5-6-15(14)25-8-4-7-23(2)3/h5-6,9-11H,4,7-8H2,1-3H3,(H2,20,21,22,24) |
| InChIKey | QIVQAAYSJDPEPN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|