C18H23ClN6O2 — CID 11956017
1-[5-chloro-2-[(1-methylpiperazin-2-yl)methoxy]phenyl]-3-(5-methylpyrazin-2-yl)urea (PubChem CID 11956017) has the molecular formula C18H23ClN6O2 and a molecular weight of 390.88 g/mol. Its IUPAC name is 1-[5-chloro-2-[(1-methylpiperazin-2-yl)methoxy]phenyl]-3-(5-methylpyrazin-2-yl)urea.
| Compound Name | 1-[5-chloro-2-[(1-methylpiperazin-2-yl)methoxy]phenyl]-3-(5-methylpyrazin-2-yl)urea |
|---|---|
| PubChem CID | 11956017 |
| Molecular Formula | C18H23ClN6O2 |
| Molecular Weight | 390.88 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 1-[5-chloro-2-[(1-methylpiperazin-2-yl)methoxy]phenyl]-3-(5-methylpyrazin-2-yl)urea |
| SMILES | Cc1cnc(NC(=O)Nc2cc(Cl)ccc2OCC2CNCCN2C)cn1 |
| InChI | InChI=1S/C18H23ClN6O2/c1-12-8-22-17(10-21-12)24-18(26)23-15-7-13(19)3-4-16(15)27-11-14-9-20-5-6-25(14)2/h3-4,7-8,10,14,20H,5-6,9,11H2,1-2H3,(H2,22,23,24,26) |
| InChIKey | IYXFSELCOYOIHB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.88 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |