C17H21N5O3S — CID 143303789
1-(5-methylpyrazin-2-yl)-3-[2-[[(2R)-morpholin-2-yl]methoxy]-5-sulfanylphenyl]urea (PubChem CID 143303789) has the molecular formula C17H21N5O3S and a molecular weight of 375.45 g/mol. Its IUPAC name is 1-(5-methylpyrazin-2-yl)-3-[2-[[(2R)-morpholin-2-yl]methoxy]-5-sulfanylphenyl]urea.
| Compound Name | 1-(5-methylpyrazin-2-yl)-3-[2-[[(2R)-morpholin-2-yl]methoxy]-5-sulfanylphenyl]urea |
|---|---|
| PubChem CID | 143303789 |
| Molecular Formula | C17H21N5O3S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 1-(5-methylpyrazin-2-yl)-3-[2-[[(2R)-morpholin-2-yl]methoxy]-5-sulfanylphenyl]urea |
| SMILES | Cc1cnc(NC(=O)Nc2cc(S)ccc2OC[C@H]2CNCCO2)cn1 |
| InChI | InChI=1S/C17H21N5O3S/c1-11-7-20-16(9-19-11)22-17(23)21-14-6-13(26)2-3-15(14)25-10-12-8-18-4-5-24-12/h2-3,6-7,9,12,18,26H,4-5,8,10H2,1H3,(H2,20,21,22,23)/t12-/m1/s1 |
| InChIKey | KKRVMPLUTOLTIH-GFCCVEGCSA-N |
| XLogP | 2.08 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|