C18H23N5O4 — CID 11955977
1-[5-methoxy-2-[[(2S)-morpholin-2-yl]methoxy]phenyl]-3-(5-methylpyrazin-2-yl)urea (PubChem CID 11955977) has the molecular formula C18H23N5O4 and a molecular weight of 373.41 g/mol. Its IUPAC name is 1-[5-methoxy-2-[[(2S)-morpholin-2-yl]methoxy]phenyl]-3-(5-methylpyrazin-2-yl)urea.
| Compound Name | 1-[5-methoxy-2-[[(2S)-morpholin-2-yl]methoxy]phenyl]-3-(5-methylpyrazin-2-yl)urea |
|---|---|
| PubChem CID | 11955977 |
| Molecular Formula | C18H23N5O4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 1-[5-methoxy-2-[[(2S)-morpholin-2-yl]methoxy]phenyl]-3-(5-methylpyrazin-2-yl)urea |
| SMILES | COc1ccc(OC[C@@H]2CNCCO2)c(NC(=O)Nc2cnc(C)cn2)c1 |
| InChI | InChI=1S/C18H23N5O4/c1-12-8-21-17(10-20-12)23-18(24)22-15-7-13(25-2)3-4-16(15)27-11-14-9-19-5-6-26-14/h3-4,7-8,10,14,19H,5-6,9,11H2,1-2H3,(H2,21,22,23,24)/t14-/m0/s1 |
| InChIKey | TWAIUVQHFOMSGJ-AWEZNQCLSA-N |
| XLogP | 1.80 |
| TPSA | 106.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |