C16H25ClN2O4 — CID 119686964
N-(2,5-diethoxyphenyl)-2-morpholin-2-ylacetamide;hydrochloride (PubChem CID 119686964) has the molecular formula C16H25ClN2O4 and a molecular weight of 344.84 g/mol. Its IUPAC name is N-(2,5-diethoxyphenyl)-2-morpholin-2-ylacetamide;hydrochloride.
| Compound Name | N-(2,5-diethoxyphenyl)-2-morpholin-2-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119686964 |
| Molecular Formula | C16H25ClN2O4 |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | N-(2,5-diethoxyphenyl)-2-morpholin-2-ylacetamide;hydrochloride |
| SMILES | CCOc1ccc(OCC)c(NC(=O)CC2CNCCO2)c1.Cl |
| InChI | InChI=1S/C16H24N2O4.ClH/c1-3-20-12-5-6-15(21-4-2)14(9-12)18-16(19)10-13-11-17-7-8-22-13;/h5-6,9,13,17H,3-4,7-8,10-11H2,1-2H3,(H,18,19);1H |
| InChIKey | GELUZUHMGUKRCD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |