C19H25N5O2 — CID 21034120
1-[5-methyl-2-[(1-methylpyrrolidin-2-yl)methoxy]phenyl]-3-(5-methylpyrazin-2-yl)urea (PubChem CID 21034120) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 1-[5-methyl-2-[(1-methylpyrrolidin-2-yl)methoxy]phenyl]-3-(5-methylpyrazin-2-yl)urea.
| Compound Name | 1-[5-methyl-2-[(1-methylpyrrolidin-2-yl)methoxy]phenyl]-3-(5-methylpyrazin-2-yl)urea |
|---|---|
| PubChem CID | 21034120 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 1-[5-methyl-2-[(1-methylpyrrolidin-2-yl)methoxy]phenyl]-3-(5-methylpyrazin-2-yl)urea |
| SMILES | Cc1ccc(OCC2CCCN2C)c(NC(=O)Nc2cnc(C)cn2)c1 |
| InChI | InChI=1S/C19H25N5O2/c1-13-6-7-17(26-12-15-5-4-8-24(15)3)16(9-13)22-19(25)23-18-11-20-14(2)10-21-18/h6-7,9-11,15H,4-5,8,12H2,1-3H3,(H2,21,22,23,25) |
| InChIKey | CBRUDKHLBYMVJQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |