C18H23N5O3 — CID 22046416
1-[5-methyl-2-(2-morpholin-4-ylethoxy)phenyl]-3-pyrazin-2-ylurea (PubChem CID 22046416) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is 1-[5-methyl-2-(2-morpholin-4-ylethoxy)phenyl]-3-pyrazin-2-ylurea.
| Compound Name | 1-[5-methyl-2-(2-morpholin-4-ylethoxy)phenyl]-3-pyrazin-2-ylurea |
|---|---|
| PubChem CID | 22046416 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 1-[5-methyl-2-(2-morpholin-4-ylethoxy)phenyl]-3-pyrazin-2-ylurea |
| SMILES | Cc1ccc(OCCN2CCOCC2)c(NC(=O)Nc2cnccn2)c1 |
| InChI | InChI=1S/C18H23N5O3/c1-14-2-3-16(26-11-8-23-6-9-25-10-7-23)15(12-14)21-18(24)22-17-13-19-4-5-20-17/h2-5,12-13H,6-11H2,1H3,(H2,20,21,22,24) |
| InChIKey | SOFUVOWVKANYHO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |