C22H31N5O2 — CID 142167522
1-[5-methyl-2-[3-(1-methylpiperidin-3-yl)propoxy]phenyl]-3-(5-methylpyrazin-2-yl)urea (PubChem CID 142167522) has the molecular formula C22H31N5O2 and a molecular weight of 397.52 g/mol. Its IUPAC name is 1-[5-methyl-2-[3-(1-methylpiperidin-3-yl)propoxy]phenyl]-3-(5-methylpyrazin-2-yl)urea.
| Compound Name | 1-[5-methyl-2-[3-(1-methylpiperidin-3-yl)propoxy]phenyl]-3-(5-methylpyrazin-2-yl)urea |
|---|---|
| PubChem CID | 142167522 |
| Molecular Formula | C22H31N5O2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | 1-[5-methyl-2-[3-(1-methylpiperidin-3-yl)propoxy]phenyl]-3-(5-methylpyrazin-2-yl)urea |
| SMILES | Cc1ccc(OCCCC2CCCN(C)C2)c(NC(=O)Nc2cnc(C)cn2)c1 |
| InChI | InChI=1S/C22H31N5O2/c1-16-8-9-20(29-11-5-7-18-6-4-10-27(3)15-18)19(12-16)25-22(28)26-21-14-23-17(2)13-24-21/h8-9,12-14,18H,4-7,10-11,15H2,1-3H3,(H2,24,25,26,28) |
| InChIKey | GOLVTFWPIWZYBK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|