C24H24ClN7O3 — CID 143085113
1-[3-[4-chloro-2-[(5-cyano-2-pyridinyl)carbamoylamino]phenoxy]propyl]-3-[4-(methylamino)phenyl]urea (PubChem CID 143085113) has the molecular formula C24H24ClN7O3 and a molecular weight of 493.96 g/mol. Its IUPAC name is 1-[3-[4-chloro-2-[(5-cyano-2-pyridinyl)carbamoylamino]phenoxy]propyl]-3-[4-(methylamino)phenyl]urea.
| Compound Name | 1-[3-[4-chloro-2-[(5-cyano-2-pyridinyl)carbamoylamino]phenoxy]propyl]-3-[4-(methylamino)phenyl]urea |
|---|---|
| PubChem CID | 143085113 |
| Molecular Formula | C24H24ClN7O3 |
| Molecular Weight | 493.96 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | 1-[3-[4-chloro-2-[(5-cyano-2-pyridinyl)carbamoylamino]phenoxy]propyl]-3-[4-(methylamino)phenyl]urea |
| SMILES | CNc1ccc(NC(=O)NCCCOc2ccc(Cl)cc2NC(=O)Nc2ccc(C#N)cn2)cc1 |
| InChI | InChI=1S/C24H24ClN7O3/c1-27-18-5-7-19(8-6-18)30-23(33)28-11-2-12-35-21-9-4-17(25)13-20(21)31-24(34)32-22-10-3-16(14-26)15-29-22/h3-10,13,15,27H,2,11-12H2,1H3,(H2,28,30,33)(H2,29,31,32,34) |
| InChIKey | HJRKYKPVKHVQMP-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 140.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.96 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|