C19H24N6O3 — CID 142167508
3-[3-(dimethylamino)propoxy]-N-methylidene-4-[(5-methylpyrazin-2-yl)carbamoylamino]benzamide (PubChem CID 142167508) has the molecular formula C19H24N6O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is 3-[3-(dimethylamino)propoxy]-N-methylidene-4-[(5-methylpyrazin-2-yl)carbamoylamino]benzamide.
| Compound Name | 3-[3-(dimethylamino)propoxy]-N-methylidene-4-[(5-methylpyrazin-2-yl)carbamoylamino]benzamide |
|---|---|
| PubChem CID | 142167508 |
| Molecular Formula | C19H24N6O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 3-[3-(dimethylamino)propoxy]-N-methylidene-4-[(5-methylpyrazin-2-yl)carbamoylamino]benzamide |
| SMILES | C=NC(=O)c1ccc(NC(=O)Nc2cnc(C)cn2)c(OCCCN(C)C)c1 |
| InChI | InChI=1S/C19H24N6O3/c1-13-11-22-17(12-21-13)24-19(27)23-15-7-6-14(18(26)20-2)10-16(15)28-9-5-8-25(3)4/h6-7,10-12H,2,5,8-9H2,1,3-4H3,(H2,22,23,24,27) |
| InChIKey | UZISVVQUNPZLED-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 108.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|