C19H18N6O3 — CID 22046409
4-[(5-methylpyrazin-2-yl)carbamoylamino]-3-(pyridin-3-ylmethoxy)benzamide (PubChem CID 22046409) has the molecular formula C19H18N6O3 and a molecular weight of 378.39 g/mol. Its IUPAC name is 4-[(5-methylpyrazin-2-yl)carbamoylamino]-3-(pyridin-3-ylmethoxy)benzamide.
| Compound Name | 4-[(5-methylpyrazin-2-yl)carbamoylamino]-3-(pyridin-3-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 22046409 |
| Molecular Formula | C19H18N6O3 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 4-[(5-methylpyrazin-2-yl)carbamoylamino]-3-(pyridin-3-ylmethoxy)benzamide |
| SMILES | Cc1cnc(NC(=O)Nc2ccc(C(N)=O)cc2OCc2cccnc2)cn1 |
| InChI | InChI=1S/C19H18N6O3/c1-12-8-23-17(10-22-12)25-19(27)24-15-5-4-14(18(20)26)7-16(15)28-11-13-3-2-6-21-9-13/h2-10H,11H2,1H3,(H2,20,26)(H2,23,24,25,27) |
| InChIKey | FVCYTBPYWUUOKP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |