About [5-(chloromethoxy)-5-oxopentyl] 2-methylhexanoate
[5-(chloromethoxy)-5-oxopentyl] 2-methylhexanoate (PubChem CID 156724586) has the molecular formula C13H23ClO4
and a molecular weight of 278.78 g/mol. Its IUPAC name is [5-(chloromethoxy)-5-oxopentyl] 2-methylhexanoate.
Molecular Properties
| Compound Name | [5-(chloromethoxy)-5-oxopentyl] 2-methylhexanoate |
| PubChem CID | 156724586 |
| Molecular Formula | C13H23ClO4 |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | [5-(chloromethoxy)-5-oxopentyl] 2-methylhexanoate |
| SMILES | CCCCC(C)C(=O)OCCCCC(=O)OCCl |
| InChI | InChI=1S/C13H23ClO4/c1-3-4-7-11(2)13(16)17-9-6-5-8-12(15)18-10-14/h11H,3-10H2,1-2H3 |
| InChIKey | RBCOLQXHVIJNOY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [5-(chloromethoxy)-5-oxopentyl] 2-methylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(chloromethoxy)-5-oxopentyl] 2-methylhexanoate?
The IUPAC name of [5-(chloromethoxy)-5-oxopentyl] 2-methylhexanoate (CID 156724586) is [5-(chloromethoxy)-5-oxopentyl] 2-methylhexanoate.
What is the SMILES notation for [5-(chloromethoxy)-5-oxopentyl] 2-methylhexanoate?
The canonical SMILES for [5-(chloromethoxy)-5-oxopentyl] 2-methylhexanoate is CCCCC(C)C(=O)OCCCCC(=O)OCCl.
What is the InChIKey of [5-(chloromethoxy)-5-oxopentyl] 2-methylhexanoate?
The InChIKey is RBCOLQXHVIJNOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23ClO4/c1-3-4-7-11(2)13(16)17-9-6-5-8-12(15)18-10-14/h11H,3-10H2,1-2H3.
What are the key properties of [5-(chloromethoxy)-5-oxopentyl] 2-methylhexanoate?
[5-(chloromethoxy)-5-oxopentyl] 2-methylhexanoate has a molecular weight of 278.78 g/mol, XLogP of 3.27, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(chloromethoxy)-5-oxopentyl] 2-methylhexanoate is sourced from PubChem (CID 156724586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).