C11H11N2Rb3 — CID 156726542
ethane;3-methyl-5,7-dihydro-4H-1,6-naphthyridine-4,5,7-triide;tris(rubidium(1+)) (PubChem CID 156726542) has the molecular formula C11H11N2Rb3 and a molecular weight of 427.63 g/mol. Its IUPAC name is ethane;3-methyl-5,7-dihydro-4H-1,6-naphthyridine-4,5,7-triide;tris(rubidium(1+)).
| Compound Name | ethane;3-methyl-5,7-dihydro-4H-1,6-naphthyridine-4,5,7-triide;tris(rubidium(1+)) |
|---|---|
| PubChem CID | 156726542 |
| Molecular Formula | C11H11N2Rb3 |
| Molecular Weight | 427.63 g/mol |
| Exact Mass | 425.83 |
| IUPAC Name | ethane;3-methyl-5,7-dihydro-4H-1,6-naphthyridine-4,5,7-triide;tris(rubidium(1+)) |
| SMILES | CC.Cc1[c-]c2[c-]n[c-]cc2nc1.[Rb+].[Rb+].[Rb+] |
| InChI | InChI=1S/C9H5N2.C2H6.3Rb/c1-7-4-8-6-10-3-2-9(8)11-5-7;1-2;;;/h2,5H,1H3;1-2H3;;;/q-3;;3*+1 |
| InChIKey | IFEKLZREEZPLHM-UHFFFAOYSA-N |
| XLogP | -6.62 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.63 |
| LogP ≤ 5 | -6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|