C18H32N5O5P — CID 156726763
2-[2-[1-(6-amino-2,3-dihydropurin-9-yl)propan-2-yloxymethyl]-1,3,2-dioxaphosphinan-5-yl]acetaldehyde;2-methoxypropane (PubChem CID 156726763) has the molecular formula C18H32N5O5P and a molecular weight of 429.46 g/mol. Its IUPAC name is 2-[2-[1-(6-amino-2,3-dihydropurin-9-yl)propan-2-yloxymethyl]-1,3,2-dioxaphosphinan-5-yl]acetaldehyde;2-methoxypropane.
| Compound Name | 2-[2-[1-(6-amino-2,3-dihydropurin-9-yl)propan-2-yloxymethyl]-1,3,2-dioxaphosphinan-5-yl]acetaldehyde;2-methoxypropane |
|---|---|
| PubChem CID | 156726763 |
| Molecular Formula | C18H32N5O5P |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 2-[2-[1-(6-amino-2,3-dihydropurin-9-yl)propan-2-yloxymethyl]-1,3,2-dioxaphosphinan-5-yl]acetaldehyde;2-methoxypropane |
| SMILES | CC(Cn1cnc2c1NCN=C2N)OCP1OCC(CC=O)CO1.COC(C)C |
| InChI | InChI=1S/C14H22N5O4P.C4H10O/c1-10(21-9-24-22-5-11(2-3-20)6-23-24)4-19-8-18-12-13(15)16-7-17-14(12)19;1-4(2)5-3/h3,8,10-11,17H,2,4-7,9H2,1H3,(H2,15,16);4H,1-3H3 |
| InChIKey | WLVGPBNISDVNKT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|