C14H22N5O4P — CID 156726764
2-[2-[1-(6-amino-2,3-dihydropurin-9-yl)propan-2-yloxymethyl]-1,3,2-dioxaphosphinan-5-yl]acetaldehyde (PubChem CID 156726764) has the molecular formula C14H22N5O4P and a molecular weight of 355.34 g/mol. Its IUPAC name is 2-[2-[1-(6-amino-2,3-dihydropurin-9-yl)propan-2-yloxymethyl]-1,3,2-dioxaphosphinan-5-yl]acetaldehyde.
| Compound Name | 2-[2-[1-(6-amino-2,3-dihydropurin-9-yl)propan-2-yloxymethyl]-1,3,2-dioxaphosphinan-5-yl]acetaldehyde |
|---|---|
| PubChem CID | 156726764 |
| Molecular Formula | C14H22N5O4P |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 2-[2-[1-(6-amino-2,3-dihydropurin-9-yl)propan-2-yloxymethyl]-1,3,2-dioxaphosphinan-5-yl]acetaldehyde |
| SMILES | CC(Cn1cnc2c1NCN=C2N)OCP1OCC(CC=O)CO1 |
| InChI | InChI=1S/C14H22N5O4P/c1-10(21-9-24-22-5-11(2-3-20)6-23-24)4-19-8-18-12-13(15)16-7-17-14(12)19/h3,8,10-11,17H,2,4-7,9H2,1H3,(H2,15,16) |
| InChIKey | LIBYQTPIASWTSI-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|