About 3-ethyl-2H-indazole;molecular hydrogen
3-ethyl-2H-indazole;molecular hydrogen (PubChem CID 156727025) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 3-ethyl-2H-indazole;molecular hydrogen.
Molecular Properties
| Compound Name | 3-ethyl-2H-indazole;molecular hydrogen |
| PubChem CID | 156727025 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 3-ethyl-2H-indazole;molecular hydrogen |
| SMILES | CCc1[nH]nc2ccccc12.[H][H] |
| InChI | InChI=1S/C9H10N2.H2/c1-2-8-7-5-3-4-6-9(7)11-10-8;/h3-6H,2H2,1H3,(H,10,11);1H |
| InChIKey | FWCJZRBLRQITBF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethyl-2H-indazole;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2H-indazole;molecular hydrogen?
The IUPAC name of 3-ethyl-2H-indazole;molecular hydrogen (CID 156727025) is 3-ethyl-2H-indazole;molecular hydrogen.
What is the SMILES notation for 3-ethyl-2H-indazole;molecular hydrogen?
The canonical SMILES for 3-ethyl-2H-indazole;molecular hydrogen is CCc1[nH]nc2ccccc12.[H][H].
What is the InChIKey of 3-ethyl-2H-indazole;molecular hydrogen?
The InChIKey is FWCJZRBLRQITBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2.H2/c1-2-8-7-5-3-4-6-9(7)11-10-8;/h3-6H,2H2,1H3,(H,10,11);1H.
What are the key properties of 3-ethyl-2H-indazole;molecular hydrogen?
3-ethyl-2H-indazole;molecular hydrogen has a molecular weight of 148.21 g/mol, XLogP of 2.37, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2H-indazole;molecular hydrogen is sourced from PubChem (CID 156727025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).