3-ethyl-2H-indazole;molecular hydrogen

C9H12N2 — CID 156727025

IUPAC3-ethyl-2H-indazole;molecular hydrogen
SMILESCCc1[nH]nc2ccccc12.[H][H]
InChIInChI=1S/C9H10N2.H2/c1-2-8-7-5-3-4-6-9(7)11-10-8;/h3-6H,2H2,1H3,(H,10,11);1H
InChIKeyFWCJZRBLRQITBF-UHFFFAOYSA-N
MW148.21 g/mol
LogP2.37
Rot. Bonds1

About 3-ethyl-2H-indazole;molecular hydrogen

3-ethyl-2H-indazole;molecular hydrogen (PubChem CID 156727025) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 3-ethyl-2H-indazole;molecular hydrogen.

Molecular Properties

Compound Name3-ethyl-2H-indazole;molecular hydrogen
PubChem CID156727025
Molecular FormulaC9H12N2
Molecular Weight148.21 g/mol
Exact Mass148.10
IUPAC Name3-ethyl-2H-indazole;molecular hydrogen
SMILESCCc1[nH]nc2ccccc12.[H][H]
InChIInChI=1S/C9H10N2.H2/c1-2-8-7-5-3-4-6-9(7)11-10-8;/h3-6H,2H2,1H3,(H,10,11);1H
InChIKeyFWCJZRBLRQITBF-UHFFFAOYSA-N
XLogP2.37
TPSA28.68 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500148.21
LogP ≤ 52.37
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 3-ethyl-2H-indazole;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-ethyl-2H-indazole;molecular hydrogen?
The IUPAC name of 3-ethyl-2H-indazole;molecular hydrogen (CID 156727025) is 3-ethyl-2H-indazole;molecular hydrogen.
What is the SMILES notation for 3-ethyl-2H-indazole;molecular hydrogen?
The canonical SMILES for 3-ethyl-2H-indazole;molecular hydrogen is CCc1[nH]nc2ccccc12.[H][H].
What is the InChIKey of 3-ethyl-2H-indazole;molecular hydrogen?
The InChIKey is FWCJZRBLRQITBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2.H2/c1-2-8-7-5-3-4-6-9(7)11-10-8;/h3-6H,2H2,1H3,(H,10,11);1H.
What are the key properties of 3-ethyl-2H-indazole;molecular hydrogen?
3-ethyl-2H-indazole;molecular hydrogen has a molecular weight of 148.21 g/mol, XLogP of 2.37, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2H-indazole;molecular hydrogen is sourced from PubChem (CID 156727025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).