C16H24ClNO3 — CID 156727751
4-(2-chloroethyl)-1-(cyclohex-2-en-1-ylmethyl)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione;ethane (PubChem CID 156727751) has the molecular formula C16H24ClNO3 and a molecular weight of 313.83 g/mol. Its IUPAC name is 4-(2-chloroethyl)-1-(cyclohex-2-en-1-ylmethyl)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione;ethane.
| Compound Name | 4-(2-chloroethyl)-1-(cyclohex-2-en-1-ylmethyl)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione;ethane |
|---|---|
| PubChem CID | 156727751 |
| Molecular Formula | C16H24ClNO3 |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 4-(2-chloroethyl)-1-(cyclohex-2-en-1-ylmethyl)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione;ethane |
| SMILES | CC.O=C1NC2(CC3C=CCCC3)C(=O)OC2C1CCCl |
| InChI | InChI=1S/C14H18ClNO3.C2H6/c15-7-6-10-11-14(13(18)19-11,16-12(10)17)8-9-4-2-1-3-5-9;1-2/h2,4,9-11H,1,3,5-8H2,(H,16,17);1-2H3 |
| InChIKey | YTGMVKZVXDNMQR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|