C39H59N4O4S2- — CID 156728117
[3-(4-decoxyphenyl)sulfonyl-4-[4-(2-piperidin-1-ylethyl)-1,4-diazepan-1-yl]quinolin-6-yl]-dimethyl-oxido-λ4-sulfane (PubChem CID 156728117) has the molecular formula C39H59N4O4S2- and a molecular weight of 712.06 g/mol. Its IUPAC name is [3-(4-decoxyphenyl)sulfonyl-4-[4-(2-piperidin-1-ylethyl)-1,4-diazepan-1-yl]quinolin-6-yl]-dimethyl-oxido-λ4-sulfane.
| Compound Name | [3-(4-decoxyphenyl)sulfonyl-4-[4-(2-piperidin-1-ylethyl)-1,4-diazepan-1-yl]quinolin-6-yl]-dimethyl-oxido-λ4-sulfane |
|---|---|
| PubChem CID | 156728117 |
| Molecular Formula | C39H59N4O4S2- |
| Molecular Weight | 712.06 g/mol |
| Exact Mass | 711.40 |
| IUPAC Name | [3-(4-decoxyphenyl)sulfonyl-4-[4-(2-piperidin-1-ylethyl)-1,4-diazepan-1-yl]quinolin-6-yl]-dimethyl-oxido-λ4-sulfane |
| SMILES | CCCCCCCCCCOc1ccc(S(=O)(=O)c2cnc3ccc(S(C)(C)[O-])cc3c2N2CCCN(CCN3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C39H60N4O4S2/c1-4-5-6-7-8-9-10-14-30-47-33-16-18-34(19-17-33)49(45,46)38-32-40-37-21-20-35(48(2,3)44)31-36(37)39(38)43-25-15-24-42(28-29-43)27-26-41-22-12-11-13-23-41/h16-21,31-32,44H,4-15,22-30H2,1-3H3/p-1 |
| InChIKey | DNGYXTLFGBEQBV-UHFFFAOYSA-M |
| XLogP | 8.14 |
| TPSA | 89.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.06 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|