C19H36O — CID 15672921
(7R,11R)-7,11,15-trimethylhexadec-2-yn-1-ol (PubChem CID 15672921) has the molecular formula C19H36O and a molecular weight of 280.50 g/mol. Its IUPAC name is (7R,11R)-7,11,15-trimethylhexadec-2-yn-1-ol.
| Compound Name | (7R,11R)-7,11,15-trimethylhexadec-2-yn-1-ol |
|---|---|
| PubChem CID | 15672921 |
| Molecular Formula | C19H36O |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.28 |
| IUPAC Name | (7R,11R)-7,11,15-trimethylhexadec-2-yn-1-ol |
| SMILES | CC(C)CCC[C@@H](C)CCC[C@@H](C)CCCC#CCO |
| InChI | InChI=1S/C19H36O/c1-17(2)11-9-13-19(4)15-10-14-18(3)12-7-5-6-8-16-20/h17-20H,5,7,9-16H2,1-4H3/t18-,19+/m0/s1 |
| InChIKey | VBDLQRXGNHMUFD-RBUKOAKNSA-N |
| XLogP | 5.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|