About 6-amino-3-(2-oxopropoxy)-1H-quinolin-2-one;molecular hydrogen;hydrochloride
6-amino-3-(2-oxopropoxy)-1H-quinolin-2-one;molecular hydrogen;hydrochloride (PubChem CID 156729282) has the molecular formula C12H15ClN2O3
and a molecular weight of 270.72 g/mol. Its IUPAC name is 6-amino-3-(2-oxopropoxy)-1H-quinolin-2-one;molecular hydrogen;hydrochloride.
Molecular Properties
| Compound Name | 6-amino-3-(2-oxopropoxy)-1H-quinolin-2-one;molecular hydrogen;hydrochloride |
| PubChem CID | 156729282 |
| Molecular Formula | C12H15ClN2O3 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 6-amino-3-(2-oxopropoxy)-1H-quinolin-2-one;molecular hydrogen;hydrochloride |
| SMILES | CC(=O)COc1cc2cc(N)ccc2[nH]c1=O.Cl.[H][H] |
| InChI | InChI=1S/C12H12N2O3.ClH.H2/c1-7(15)6-17-11-5-8-4-9(13)2-3-10(8)14-12(11)16;;/h2-5H,6,13H2,1H3,(H,14,16);2*1H |
| InChIKey | FPKKHPAJJBQYGE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 85.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-3-(2-oxopropoxy)-1H-quinolin-2-one;molecular hydrogen;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-3-(2-oxopropoxy)-1H-quinolin-2-one;molecular hydrogen;hydrochloride?
The IUPAC name of 6-amino-3-(2-oxopropoxy)-1H-quinolin-2-one;molecular hydrogen;hydrochloride (CID 156729282) is 6-amino-3-(2-oxopropoxy)-1H-quinolin-2-one;molecular hydrogen;hydrochloride.
What is the SMILES notation for 6-amino-3-(2-oxopropoxy)-1H-quinolin-2-one;molecular hydrogen;hydrochloride?
The canonical SMILES for 6-amino-3-(2-oxopropoxy)-1H-quinolin-2-one;molecular hydrogen;hydrochloride is CC(=O)COc1cc2cc(N)ccc2[nH]c1=O.Cl.[H][H].
What is the InChIKey of 6-amino-3-(2-oxopropoxy)-1H-quinolin-2-one;molecular hydrogen;hydrochloride?
The InChIKey is FPKKHPAJJBQYGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O3.ClH.H2/c1-7(15)6-17-11-5-8-4-9(13)2-3-10(8)14-12(11)16;;/h2-5H,6,13H2,1H3,(H,14,16);2*1H.
What are the key properties of 6-amino-3-(2-oxopropoxy)-1H-quinolin-2-one;molecular hydrogen;hydrochloride?
6-amino-3-(2-oxopropoxy)-1H-quinolin-2-one;molecular hydrogen;hydrochloride has a molecular weight of 270.72 g/mol, XLogP of 1.75, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3-(2-oxopropoxy)-1H-quinolin-2-one;molecular hydrogen;hydrochloride is sourced from PubChem (CID 156729282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).