C21H24ClN5O2 — CID 156729296
6-[(5-chloro-2-piperidin-1-ylpyrimidin-4-yl)amino]-3-ethoxy-1-methylquinolin-2-one (PubChem CID 156729296) has the molecular formula C21H24ClN5O2 and a molecular weight of 413.91 g/mol. Its IUPAC name is 6-[(5-chloro-2-piperidin-1-ylpyrimidin-4-yl)amino]-3-ethoxy-1-methylquinolin-2-one.
| Compound Name | 6-[(5-chloro-2-piperidin-1-ylpyrimidin-4-yl)amino]-3-ethoxy-1-methylquinolin-2-one |
|---|---|
| PubChem CID | 156729296 |
| Molecular Formula | C21H24ClN5O2 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 6-[(5-chloro-2-piperidin-1-ylpyrimidin-4-yl)amino]-3-ethoxy-1-methylquinolin-2-one |
| SMILES | CCOc1cc2cc(Nc3nc(N4CCCCC4)ncc3Cl)ccc2n(C)c1=O |
| InChI | InChI=1S/C21H24ClN5O2/c1-3-29-18-12-14-11-15(7-8-17(14)26(2)20(18)28)24-19-16(22)13-23-21(25-19)27-9-5-4-6-10-27/h7-8,11-13H,3-6,9-10H2,1-2H3,(H,23,24,25) |
| InChIKey | QLUXMLXEEAYYQK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |