C23H23ClN6O — CID 167559467
6-[(5-chloro-2-piperidin-1-ylpyrimidin-4-yl)amino]-1-methyl-3-pyrrol-1-ylquinolin-2-one (PubChem CID 167559467) has the molecular formula C23H23ClN6O and a molecular weight of 434.93 g/mol. Its IUPAC name is 6-[(5-chloro-2-piperidin-1-ylpyrimidin-4-yl)amino]-1-methyl-3-pyrrol-1-ylquinolin-2-one.
| Compound Name | 6-[(5-chloro-2-piperidin-1-ylpyrimidin-4-yl)amino]-1-methyl-3-pyrrol-1-ylquinolin-2-one |
|---|---|
| PubChem CID | 167559467 |
| Molecular Formula | C23H23ClN6O |
| Molecular Weight | 434.93 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 6-[(5-chloro-2-piperidin-1-ylpyrimidin-4-yl)amino]-1-methyl-3-pyrrol-1-ylquinolin-2-one |
| SMILES | Cn1c(=O)c(-n2cccc2)cc2cc(Nc3nc(N4CCCCC4)ncc3Cl)ccc21 |
| InChI | InChI=1S/C23H23ClN6O/c1-28-19-8-7-17(13-16(19)14-20(22(28)31)29-9-5-6-10-29)26-21-18(24)15-25-23(27-21)30-11-3-2-4-12-30/h5-10,13-15H,2-4,11-12H2,1H3,(H,25,26,27) |
| InChIKey | SFZAYHUBCLUCLO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.93 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |