C21H22ClIN4O3 — CID 156729374
6-[2-chloro-5-(4-iodopiperidin-1-yl)-4-nitroanilino]-1-methyl-3,4-dihydroquinolin-2-one (PubChem CID 156729374) has the molecular formula C21H22ClIN4O3 and a molecular weight of 540.79 g/mol. Its IUPAC name is 6-[2-chloro-5-(4-iodopiperidin-1-yl)-4-nitroanilino]-1-methyl-3,4-dihydroquinolin-2-one.
| Compound Name | 6-[2-chloro-5-(4-iodopiperidin-1-yl)-4-nitroanilino]-1-methyl-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 156729374 |
| Molecular Formula | C21H22ClIN4O3 |
| Molecular Weight | 540.79 g/mol |
| Exact Mass | 540.04 |
| IUPAC Name | 6-[2-chloro-5-(4-iodopiperidin-1-yl)-4-nitroanilino]-1-methyl-3,4-dihydroquinolin-2-one |
| SMILES | CN1C(=O)CCc2cc(Nc3cc(N4CCC(I)CC4)c([N+](=O)[O-])cc3Cl)ccc21 |
| InChI | InChI=1S/C21H22ClIN4O3/c1-25-18-4-3-15(10-13(18)2-5-21(25)28)24-17-12-19(20(27(29)30)11-16(17)22)26-8-6-14(23)7-9-26/h3-4,10-12,14,24H,2,5-9H2,1H3 |
| InChIKey | HWCCIRHBUQHGFI-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.79 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|