C26H45N3 — CID 156729435
N,N-dimethyl-1-[[1-(4-prop-1-ynylphenyl)piperidin-4-yl]methyl]piperidin-4-amine;ethane (PubChem CID 156729435) has the molecular formula C26H45N3 and a molecular weight of 399.67 g/mol. Its IUPAC name is N,N-dimethyl-1-[[1-(4-prop-1-ynylphenyl)piperidin-4-yl]methyl]piperidin-4-amine;ethane.
| Compound Name | N,N-dimethyl-1-[[1-(4-prop-1-ynylphenyl)piperidin-4-yl]methyl]piperidin-4-amine;ethane |
|---|---|
| PubChem CID | 156729435 |
| Molecular Formula | C26H45N3 |
| Molecular Weight | 399.67 g/mol |
| Exact Mass | 399.36 |
| IUPAC Name | N,N-dimethyl-1-[[1-(4-prop-1-ynylphenyl)piperidin-4-yl]methyl]piperidin-4-amine;ethane |
| SMILES | CC.CC.CC#Cc1ccc(N2CCC(CN3CCC(N(C)C)CC3)CC2)cc1 |
| InChI | InChI=1S/C22H33N3.2C2H6/c1-4-5-19-6-8-22(9-7-19)25-16-10-20(11-17-25)18-24-14-12-21(13-15-24)23(2)3;2*1-2/h6-9,20-21H,10-18H2,1-3H3;2*1-2H3 |
| InChIKey | PAPLFJIHVBEHAN-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.67 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|