About N,N-dimethyl-1-[[1-(4-prop-1-ynylphenyl)piperidin-4-yl]methyl]piperidin-4-amine;ethane
N,N-dimethyl-1-[[1-(4-prop-1-ynylphenyl)piperidin-4-yl]methyl]piperidin-4-amine;ethane (PubChem CID 156729435) has the molecular formula C26H45N3
and a molecular weight of 399.67 g/mol. Its IUPAC name is N,N-dimethyl-1-[[1-(4-prop-1-ynylphenyl)piperidin-4-yl]methyl]piperidin-4-amine;ethane.
Molecular Properties
| Compound Name | N,N-dimethyl-1-[[1-(4-prop-1-ynylphenyl)piperidin-4-yl]methyl]piperidin-4-amine;ethane |
| PubChem CID | 156729435 |
| Molecular Formula | C26H45N3 |
| Molecular Weight | 399.67 g/mol |
| Exact Mass | 399.36 |
| IUPAC Name | N,N-dimethyl-1-[[1-(4-prop-1-ynylphenyl)piperidin-4-yl]methyl]piperidin-4-amine;ethane |
| SMILES | CC.CC.CC#Cc1ccc(N2CCC(CN3CCC(N(C)C)CC3)CC2)cc1 |
| InChI | InChI=1S/C22H33N3.2C2H6/c1-4-5-19-6-8-22(9-7-19)25-16-10-20(11-17-25)18-24-14-12-21(13-15-24)23(2)3;2*1-2/h6-9,20-21H,10-18H2,1-3H3;2*1-2H3 |
| InChIKey | PAPLFJIHVBEHAN-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.67 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-1-[[1-(4-prop-1-ynylphenyl)piperidin-4-yl]methyl]piperidin-4-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-1-[[1-(4-prop-1-ynylphenyl)piperidin-4-yl]methyl]piperidin-4-amine;ethane?
The IUPAC name of N,N-dimethyl-1-[[1-(4-prop-1-ynylphenyl)piperidin-4-yl]methyl]piperidin-4-amine;ethane (CID 156729435) is N,N-dimethyl-1-[[1-(4-prop-1-ynylphenyl)piperidin-4-yl]methyl]piperidin-4-amine;ethane.
What is the SMILES notation for N,N-dimethyl-1-[[1-(4-prop-1-ynylphenyl)piperidin-4-yl]methyl]piperidin-4-amine;ethane?
The canonical SMILES for N,N-dimethyl-1-[[1-(4-prop-1-ynylphenyl)piperidin-4-yl]methyl]piperidin-4-amine;ethane is CC.CC.CC#Cc1ccc(N2CCC(CN3CCC(N(C)C)CC3)CC2)cc1.
What is the InChIKey of N,N-dimethyl-1-[[1-(4-prop-1-ynylphenyl)piperidin-4-yl]methyl]piperidin-4-amine;ethane?
The InChIKey is PAPLFJIHVBEHAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H33N3.2C2H6/c1-4-5-19-6-8-22(9-7-19)25-16-10-20(11-17-25)18-24-14-12-21(13-15-24)23(2)3;2*1-2/h6-9,20-21H,10-18H2,1-3H3;2*1-2H3.
What are the key properties of N,N-dimethyl-1-[[1-(4-prop-1-ynylphenyl)piperidin-4-yl]methyl]piperidin-4-amine;ethane?
N,N-dimethyl-1-[[1-(4-prop-1-ynylphenyl)piperidin-4-yl]methyl]piperidin-4-amine;ethane has a molecular weight of 399.67 g/mol, XLogP of 5.35, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-1-[[1-(4-prop-1-ynylphenyl)piperidin-4-yl]methyl]piperidin-4-amine;ethane is sourced from PubChem (CID 156729435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).