C15H19BN2O7 — CID 156730191
6-[1-(2-amino-2-oxoethyl)azetidin-3-yl]oxy-3-[(1R,2S)-2-boronocyclopropyl]-2-hydroxybenzoic acid (PubChem CID 156730191) has the molecular formula C15H19BN2O7 and a molecular weight of 350.14 g/mol. Its IUPAC name is 6-[1-(2-amino-2-oxoethyl)azetidin-3-yl]oxy-3-[(1R,2S)-2-boronocyclopropyl]-2-hydroxybenzoic acid.
| Compound Name | 6-[1-(2-amino-2-oxoethyl)azetidin-3-yl]oxy-3-[(1R,2S)-2-boronocyclopropyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 156730191 |
| Molecular Formula | C15H19BN2O7 |
| Molecular Weight | 350.14 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 6-[1-(2-amino-2-oxoethyl)azetidin-3-yl]oxy-3-[(1R,2S)-2-boronocyclopropyl]-2-hydroxybenzoic acid |
| SMILES | NC(=O)CN1CC(Oc2ccc([C@@H]3C[C@@H]3B(O)O)c(O)c2C(=O)O)C1 |
| InChI | InChI=1S/C15H19BN2O7/c17-12(19)6-18-4-7(5-18)25-11-2-1-8(9-3-10(9)16(23)24)14(20)13(11)15(21)22/h1-2,7,9-10,20,23-24H,3-6H2,(H2,17,19)(H,21,22)/t9-,10-/m0/s1 |
| InChIKey | CBMZXWQYHLUSJU-UWVGGRQHSA-N |
| XLogP | -1.03 |
| TPSA | 153.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.14 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|