C18H25BN2O8 — CID 174039331
6-[1-[2-amino-3-hydroxy-2-(hydroxymethyl)propyl]azetidin-3-yl]oxy-3-[(1R,4R)-4-boronocyclobut-2-en-1-yl]-2-hydroxybenzoic acid (PubChem CID 174039331) has the molecular formula C18H25BN2O8 and a molecular weight of 408.22 g/mol. Its IUPAC name is 6-[1-[2-amino-3-hydroxy-2-(hydroxymethyl)propyl]azetidin-3-yl]oxy-3-[(1R,4R)-4-boronocyclobut-2-en-1-yl]-2-hydroxybenzoic acid.
| Compound Name | 6-[1-[2-amino-3-hydroxy-2-(hydroxymethyl)propyl]azetidin-3-yl]oxy-3-[(1R,4R)-4-boronocyclobut-2-en-1-yl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 174039331 |
| Molecular Formula | C18H25BN2O8 |
| Molecular Weight | 408.22 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 6-[1-[2-amino-3-hydroxy-2-(hydroxymethyl)propyl]azetidin-3-yl]oxy-3-[(1R,4R)-4-boronocyclobut-2-en-1-yl]-2-hydroxybenzoic acid |
| SMILES | NC(CO)(CO)CN1CC(Oc2ccc([C@H]3C=C[C@H]3B(O)O)c(O)c2C(=O)O)C1 |
| InChI | InChI=1S/C18H25BN2O8/c20-18(8-22,9-23)7-21-5-10(6-21)29-14-4-2-12(16(24)15(14)17(25)26)11-1-3-13(11)19(27)28/h1-4,10-11,13,22-24,27-28H,5-9,20H2,(H,25,26)/t11-,13-/m1/s1 |
| InChIKey | IBRXMAKLYIRBAO-DGCLKSJQSA-N |
| XLogP | -1.67 |
| TPSA | 176.94 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.22 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|