C17H22BN2O8- — CID 174039554
(4R)-9-[1-(2-amino-2-carboxypropyl)azetidin-3-yl]oxy-5,5-dihydroxy-6-oxa-5-boranuidatricyclo[5.4.0.02,4]undeca-1(7),8,10-triene-8-carboxylic acid (PubChem CID 174039554) has the molecular formula C17H22BN2O8- and a molecular weight of 393.18 g/mol. Its IUPAC name is (4R)-9-[1-(2-amino-2-carboxypropyl)azetidin-3-yl]oxy-5,5-dihydroxy-6-oxa-5-boranuidatricyclo[5.4.0.02,4]undeca-1(7),8,10-triene-8-carboxylic acid.
| Compound Name | (4R)-9-[1-(2-amino-2-carboxypropyl)azetidin-3-yl]oxy-5,5-dihydroxy-6-oxa-5-boranuidatricyclo[5.4.0.02,4]undeca-1(7),8,10-triene-8-carboxylic acid |
|---|---|
| PubChem CID | 174039554 |
| Molecular Formula | C17H22BN2O8- |
| Molecular Weight | 393.18 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | (4R)-9-[1-(2-amino-2-carboxypropyl)azetidin-3-yl]oxy-5,5-dihydroxy-6-oxa-5-boranuidatricyclo[5.4.0.02,4]undeca-1(7),8,10-triene-8-carboxylic acid |
| SMILES | CC(N)(CN1CC(Oc2ccc3c(c2C(=O)O)O[B-](O)(O)[C@@H]2CC32)C1)C(=O)O |
| InChI | InChI=1S/C17H22BN2O8/c1-17(19,16(23)24)7-20-5-8(6-20)27-12-3-2-9-10-4-11(10)18(25,26)28-14(9)13(12)15(21)22/h2-3,8,10-11,25-26H,4-7,19H2,1H3,(H,21,22)(H,23,24)/q-1/t10?,11-,17?/m1/s1 |
| InChIKey | WJFJRKHIPNAFCT-VVHFOWEKSA-N |
| XLogP | -0.58 |
| TPSA | 162.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.18 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|