C19H22BN4O7- — CID 174039270
(2R,4S)-9-[1-[2-amino-2-(1H-imidazol-5-yl)propanoyl]azetidin-3-yl]oxy-5,5-dihydroxy-6-oxa-5-boranuidatricyclo[5.4.0.02,4]undeca-1(7),8,10-triene-8-carboxylic acid (PubChem CID 174039270) has the molecular formula C19H22BN4O7- and a molecular weight of 429.22 g/mol. Its IUPAC name is (2R,4S)-9-[1-[2-amino-2-(1H-imidazol-5-yl)propanoyl]azetidin-3-yl]oxy-5,5-dihydroxy-6-oxa-5-boranuidatricyclo[5.4.0.02,4]undeca-1(7),8,10-triene-8-carboxylic acid.
| Compound Name | (2R,4S)-9-[1-[2-amino-2-(1H-imidazol-5-yl)propanoyl]azetidin-3-yl]oxy-5,5-dihydroxy-6-oxa-5-boranuidatricyclo[5.4.0.02,4]undeca-1(7),8,10-triene-8-carboxylic acid |
|---|---|
| PubChem CID | 174039270 |
| Molecular Formula | C19H22BN4O7- |
| Molecular Weight | 429.22 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | (2R,4S)-9-[1-[2-amino-2-(1H-imidazol-5-yl)propanoyl]azetidin-3-yl]oxy-5,5-dihydroxy-6-oxa-5-boranuidatricyclo[5.4.0.02,4]undeca-1(7),8,10-triene-8-carboxylic acid |
| SMILES | CC(N)(C(=O)N1CC(Oc2ccc3c(c2C(=O)O)O[B-](O)(O)[C@H]2C[C@@H]32)C1)c1cnc[nH]1 |
| InChI | InChI=1S/C19H22BN4O7/c1-19(21,14-5-22-8-23-14)18(27)24-6-9(7-24)30-13-3-2-10-11-4-12(11)20(28,29)31-16(10)15(13)17(25)26/h2-3,5,8-9,11-12,28-29H,4,6-7,21H2,1H3,(H,22,23)(H,25,26)/q-1/t11-,12-,19?/m0/s1 |
| InChIKey | KCPJMLWTXLWWIR-MVBRQXBDSA-N |
| XLogP | -0.25 |
| TPSA | 171.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.22 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|