C18H23BN3O7- — CID 174039373
(2R,4S)-9-[1-[(3R,5S)-5-carbamoylpyrrolidin-3-yl]azetidin-3-yl]oxy-5,5-dihydroxy-6-oxa-5-boranuidatricyclo[5.4.0.02,4]undeca-1(7),8,10-triene-8-carboxylic acid (PubChem CID 174039373) has the molecular formula C18H23BN3O7- and a molecular weight of 404.21 g/mol. Its IUPAC name is (2R,4S)-9-[1-[(3R,5S)-5-carbamoylpyrrolidin-3-yl]azetidin-3-yl]oxy-5,5-dihydroxy-6-oxa-5-boranuidatricyclo[5.4.0.02,4]undeca-1(7),8,10-triene-8-carboxylic acid.
| Compound Name | (2R,4S)-9-[1-[(3R,5S)-5-carbamoylpyrrolidin-3-yl]azetidin-3-yl]oxy-5,5-dihydroxy-6-oxa-5-boranuidatricyclo[5.4.0.02,4]undeca-1(7),8,10-triene-8-carboxylic acid |
|---|---|
| PubChem CID | 174039373 |
| Molecular Formula | C18H23BN3O7- |
| Molecular Weight | 404.21 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | (2R,4S)-9-[1-[(3R,5S)-5-carbamoylpyrrolidin-3-yl]azetidin-3-yl]oxy-5,5-dihydroxy-6-oxa-5-boranuidatricyclo[5.4.0.02,4]undeca-1(7),8,10-triene-8-carboxylic acid |
| SMILES | NC(=O)[C@@H]1C[C@@H](N2CC(Oc3ccc4c(c3C(=O)O)O[B-](O)(O)[C@H]3C[C@@H]43)C2)CN1 |
| InChI | InChI=1S/C18H23BN3O7/c20-17(23)13-3-8(5-21-13)22-6-9(7-22)28-14-2-1-10-11-4-12(11)19(26,27)29-16(10)15(14)18(24)25/h1-2,8-9,11-13,21,26-27H,3-7H2,(H2,20,23)(H,24,25)/q-1/t8-,11+,12+,13+/m1/s1 |
| InChIKey | KNFZRGDLKYSJFY-YJRXYDGGSA-N |
| XLogP | -1.16 |
| TPSA | 154.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.21 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|