C16H18BN4O6- — CID 174039426
(4R)-5,5-dihydroxy-9-[1-(1H-1,2,4-triazol-5-ylmethyl)azetidin-3-yl]oxy-6-oxa-5-boranuidatricyclo[5.4.0.02,4]undeca-1(7),8,10-triene-8-carboxylic acid (PubChem CID 174039426) has the molecular formula C16H18BN4O6- and a molecular weight of 373.15 g/mol. Its IUPAC name is (4R)-5,5-dihydroxy-9-[1-(1H-1,2,4-triazol-5-ylmethyl)azetidin-3-yl]oxy-6-oxa-5-boranuidatricyclo[5.4.0.02,4]undeca-1(7),8,10-triene-8-carboxylic acid.
| Compound Name | (4R)-5,5-dihydroxy-9-[1-(1H-1,2,4-triazol-5-ylmethyl)azetidin-3-yl]oxy-6-oxa-5-boranuidatricyclo[5.4.0.02,4]undeca-1(7),8,10-triene-8-carboxylic acid |
|---|---|
| PubChem CID | 174039426 |
| Molecular Formula | C16H18BN4O6- |
| Molecular Weight | 373.15 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | (4R)-5,5-dihydroxy-9-[1-(1H-1,2,4-triazol-5-ylmethyl)azetidin-3-yl]oxy-6-oxa-5-boranuidatricyclo[5.4.0.02,4]undeca-1(7),8,10-triene-8-carboxylic acid |
| SMILES | O=C(O)c1c(OC2CN(Cc3ncn[nH]3)C2)ccc2c1O[B-](O)(O)[C@@H]1CC21 |
| InChI | InChI=1S/C16H18BN4O6/c22-16(23)14-12(26-8-4-21(5-8)6-13-18-7-19-20-13)2-1-9-10-3-11(10)17(24,25)27-15(9)14/h1-2,7-8,10-11,24-25H,3-6H2,(H,22,23)(H,18,19,20)/q-1/t10?,11-/m1/s1 |
| InChIKey | YOVZIXGAXKDKLU-RRKGBCIJSA-N |
| XLogP | -0.06 |
| TPSA | 141.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.15 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|